C20H38N2 — CID 146212188
N,N'-bis(ethenyl)-N-pentadecan-8-ylmethanimidamide (PubChem CID 146212188) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N,N'-bis(ethenyl)-N-pentadecan-8-ylmethanimidamide.
| Compound Name | N,N'-bis(ethenyl)-N-pentadecan-8-ylmethanimidamide |
|---|---|
| PubChem CID | 146212188 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N,N'-bis(ethenyl)-N-pentadecan-8-ylmethanimidamide |
| SMILES | C=C/N=C/N(C=C)C(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C20H38N2/c1-5-9-11-13-15-17-20(18-16-14-12-10-6-2)22(8-4)19-21-7-3/h7-8,19-20H,3-6,9-18H2,1-2H3/b21-19+ |
| InChIKey | JMUPBEUOUFGLJY-XUTLUUPISA-N |
| XLogP | 6.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|