C18H23BrN2O2 — CID 146212259
3-[[5-bromo-3-(1-phenylethoxy)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 146212259) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 3-[[5-bromo-3-(1-phenylethoxy)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-bromo-3-(1-phenylethoxy)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 146212259 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-[[5-bromo-3-(1-phenylethoxy)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CC(Oc1cc(Br)cnc1OCCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H23BrN2O2/c1-14(15-8-5-4-6-9-15)23-17-12-16(19)13-20-18(17)22-11-7-10-21(2)3/h4-6,8-9,12-14H,7,10-11H2,1-3H3 |
| InChIKey | AFBAVMLIFQPVJE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|