C16H20N3O3S2- — CID 146213394
2-[(1S)-1-(2,2-dimethylpropanoylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 146213394) has the molecular formula C16H20N3O3S2- and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[(1S)-1-(2,2-dimethylpropanoylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 2-[(1S)-1-(2,2-dimethylpropanoylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 146213394 |
| Molecular Formula | C16H20N3O3S2- |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[(1S)-1-(2,2-dimethylpropanoylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CC(C)(C)C(=O)N[C@@H](Cc1ccc(NS(=O)[O-])cc1)c1nccs1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-16(2,3)15(20)18-13(14-17-8-9-23-14)10-11-4-6-12(7-5-11)19-24(21)22/h4-9,13,19H,10H2,1-3H3,(H,18,20)(H,21,22)/p-1/t13-/m0/s1 |
| InChIKey | YSZGUGLBNYHEMZ-ZDUSSCGKSA-M |
| XLogP | 2.80 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|