C12H22FNO — CID 146214051
(4R)-7-(azetidin-1-yl)-4-fluoro-2,2-dimethylheptan-3-one (PubChem CID 146214051) has the molecular formula C12H22FNO and a molecular weight of 215.31 g/mol. Its IUPAC name is (4R)-7-(azetidin-1-yl)-4-fluoro-2,2-dimethylheptan-3-one.
| Compound Name | (4R)-7-(azetidin-1-yl)-4-fluoro-2,2-dimethylheptan-3-one |
|---|---|
| PubChem CID | 146214051 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4R)-7-(azetidin-1-yl)-4-fluoro-2,2-dimethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)[C@H](F)CCCN1CCC1 |
| InChI | InChI=1S/C12H22FNO/c1-12(2,3)11(15)10(13)6-4-7-14-8-5-9-14/h10H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | MIYDFSMSSAUJJC-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |