C8H14N4O3S — CID 146216324
1-(2,2-dimethoxyethyl)-1-methyl-3-(1,2,4-thiadiazol-5-yl)urea (PubChem CID 146216324) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-1-methyl-3-(1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-1-methyl-3-(1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 146216324 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-1-methyl-3-(1,2,4-thiadiazol-5-yl)urea |
| SMILES | COC(CN(C)C(=O)Nc1ncns1)OC |
| InChI | InChI=1S/C8H14N4O3S/c1-12(4-6(14-2)15-3)8(13)11-7-9-5-10-16-7/h5-6H,4H2,1-3H3,(H,9,10,11,13) |
| InChIKey | HIQQCYLTFMZGKB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|