C13H19ClN2O4 — CID 146216460
2-(benzylamino)-4-(methoxycarbonylamino)butanoic acid;hydrochloride (PubChem CID 146216460) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-(benzylamino)-4-(methoxycarbonylamino)butanoic acid;hydrochloride.
| Compound Name | 2-(benzylamino)-4-(methoxycarbonylamino)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 146216460 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(benzylamino)-4-(methoxycarbonylamino)butanoic acid;hydrochloride |
| SMILES | COC(=O)NCCC(NCc1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C13H18N2O4.ClH/c1-19-13(18)14-8-7-11(12(16)17)15-9-10-5-3-2-4-6-10;/h2-6,11,15H,7-9H2,1H3,(H,14,18)(H,16,17);1H |
| InChIKey | VPNTXAICUKASPR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |