C33H43F3N10O4 — CID 146217868
2-[4-[1-[6-[(2S)-2-[2-(4-cyanophenyl)ethylcarbamoyl]azetidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]butanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 146217868) has the molecular formula C33H43F3N10O4 and a molecular weight of 700.77 g/mol. Its IUPAC name is 2-[4-[1-[6-[(2S)-2-[2-(4-cyanophenyl)ethylcarbamoyl]azetidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]butanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[4-[1-[6-[(2S)-2-[2-(4-cyanophenyl)ethylcarbamoyl]azetidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]butanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 146217868 |
| Molecular Formula | C33H43F3N10O4 |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.34 |
| IUPAC Name | 2-[4-[1-[6-[(2S)-2-[2-(4-cyanophenyl)ethylcarbamoyl]azetidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]butanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | N#Cc1ccc(CCNC(=O)[C@@H]2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C33H43F3N10O4/c34-33(35,36)31-43-26(19-27(44-31)46-18-13-25(46)29(48)40-15-10-22-6-8-23(20-37)9-7-22)45-16-11-21(12-17-45)3-1-5-28(47)42-24(30(49)50)4-2-14-41-32(38)39/h6-9,19,21,24-25H,1-5,10-18H2,(H,40,48)(H,42,47)(H,49,50)(H4,38,39,41)/t24?,25-/m0/s1 |
| InChIKey | BIBCJTNHWICMEK-BBMPLOMVSA-N |
| XLogP | 2.31 |
| TPSA | 215.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|