C31H41F3N10O2 — CID 146217917
(2S)-N-[2-(4-cyanophenyl)ethyl]-1-[6-[4-[4-[2-(diaminomethylideneamino)ethylamino]-4-oxobutyl]piperidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 146217917) has the molecular formula C31H41F3N10O2 and a molecular weight of 642.73 g/mol. Its IUPAC name is (2S)-N-[2-(4-cyanophenyl)ethyl]-1-[6-[4-[4-[2-(diaminomethylideneamino)ethylamino]-4-oxobutyl]piperidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(4-cyanophenyl)ethyl]-1-[6-[4-[4-[2-(diaminomethylideneamino)ethylamino]-4-oxobutyl]piperidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146217917 |
| Molecular Formula | C31H41F3N10O2 |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | (2S)-N-[2-(4-cyanophenyl)ethyl]-1-[6-[4-[4-[2-(diaminomethylideneamino)ethylamino]-4-oxobutyl]piperidin-1-yl]-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(CCNC(=O)[C@@H]2CCCN2c2cc(N3CCC(CCCC(=O)NCCN=C(N)N)CC3)nc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C31H41F3N10O2/c32-31(33,34)29-41-25(43-17-11-21(12-18-43)3-1-5-27(45)38-14-15-40-30(36)37)19-26(42-29)44-16-2-4-24(44)28(46)39-13-10-22-6-8-23(20-35)9-7-22/h6-9,19,21,24H,1-5,10-18H2,(H,38,45)(H,39,46)(H4,36,37,40)/t24-/m0/s1 |
| InChIKey | KPPDEWRFGXRDID-DEOSSOPVSA-N |
| XLogP | 2.47 |
| TPSA | 178.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|