C13H17BrFN3O3 — CID 146219929
[1-[4-bromo-2-fluoro-6-(propan-2-ylamino)anilino]-1-oxopropan-2-yl]carbamic acid (PubChem CID 146219929) has the molecular formula C13H17BrFN3O3 and a molecular weight of 362.20 g/mol. Its IUPAC name is [1-[4-bromo-2-fluoro-6-(propan-2-ylamino)anilino]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[4-bromo-2-fluoro-6-(propan-2-ylamino)anilino]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146219929 |
| Molecular Formula | C13H17BrFN3O3 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [1-[4-bromo-2-fluoro-6-(propan-2-ylamino)anilino]-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(C)Nc1cc(Br)cc(F)c1NC(=O)C(C)NC(=O)O |
| InChI | InChI=1S/C13H17BrFN3O3/c1-6(2)16-10-5-8(14)4-9(15)11(10)18-12(19)7(3)17-13(20)21/h4-7,16-17H,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | LXZUAVHLLCHATK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |