C14H12F3NO2 — CID 146220546
(6-phenyl-2-azaspiro[3.3]hept-6-en-3-yl) 2,2,2-trifluoroacetate (PubChem CID 146220546) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is (6-phenyl-2-azaspiro[3.3]hept-6-en-3-yl) 2,2,2-trifluoroacetate.
| Compound Name | (6-phenyl-2-azaspiro[3.3]hept-6-en-3-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 146220546 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (6-phenyl-2-azaspiro[3.3]hept-6-en-3-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1NCC12C=C(c1ccccc1)C2)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)12(19)20-11-13(8-18-11)6-10(7-13)9-4-2-1-3-5-9/h1-6,11,18H,7-8H2 |
| InChIKey | QWOFPCTTWHVGMT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |