C20H19ClFN3O2 — CID 146220790
2-[1-(2-chlorophenyl)-5-[2-(3-fluoro-2-methylphenyl)ethyl]pyrazol-4-yl]-N-hydroxyacetamide (PubChem CID 146220790) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-5-[2-(3-fluoro-2-methylphenyl)ethyl]pyrazol-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[1-(2-chlorophenyl)-5-[2-(3-fluoro-2-methylphenyl)ethyl]pyrazol-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 146220790 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-5-[2-(3-fluoro-2-methylphenyl)ethyl]pyrazol-4-yl]-N-hydroxyacetamide |
| SMILES | Cc1c(F)cccc1CCc1c(CC(=O)NO)cnn1-c1ccccc1Cl |
| InChI | InChI=1S/C20H19ClFN3O2/c1-13-14(5-4-7-17(13)22)9-10-18-15(11-20(26)24-27)12-23-25(18)19-8-3-2-6-16(19)21/h2-8,12,27H,9-11H2,1H3,(H,24,26) |
| InChIKey | UVFHTXZGOISNTQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|