C20H17ClFN3O2 — CID 118560026
1-(2-chlorophenyl)-5-(3-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide (PubChem CID 118560026) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(3-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-(3-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118560026 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(3-fluoro-2-methylphenyl)-N-hydroxy-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide |
| SMILES | Cc1c(F)cccc1C1(C(=O)NO)Cc2cnn(-c3ccccc3Cl)c2C1 |
| InChI | InChI=1S/C20H17ClFN3O2/c1-12-14(5-4-7-16(12)22)20(19(26)24-27)9-13-11-23-25(18(13)10-20)17-8-3-2-6-15(17)21/h2-8,11,27H,9-10H2,1H3,(H,24,26) |
| InChIKey | DZBUYIWNNVLXGN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|