C16H13F4N3O2 — CID 118559857
6-(3-fluoro-2-methylphenyl)-N-hydroxy-2-(trifluoromethyl)-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide (PubChem CID 118559857) has the molecular formula C16H13F4N3O2 and a molecular weight of 355.29 g/mol. Its IUPAC name is 6-(3-fluoro-2-methylphenyl)-N-hydroxy-2-(trifluoromethyl)-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide.
| Compound Name | 6-(3-fluoro-2-methylphenyl)-N-hydroxy-2-(trifluoromethyl)-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118559857 |
| Molecular Formula | C16H13F4N3O2 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 6-(3-fluoro-2-methylphenyl)-N-hydroxy-2-(trifluoromethyl)-5,7-dihydrocyclopenta[d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(F)cccc1C1(C(=O)NO)Cc2cnc(C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C16H13F4N3O2/c1-8-10(3-2-4-11(8)17)15(14(24)23-25)5-9-7-21-13(16(18,19)20)22-12(9)6-15/h2-4,7,25H,5-6H2,1H3,(H,23,24) |
| InChIKey | LBVKFVHDLYUGFI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|