C18H16FN5O2 — CID 118559901
5-(3-fluoro-2-methylphenyl)-N-hydroxy-1-pyrazin-2-yl-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide (PubChem CID 118559901) has the molecular formula C18H16FN5O2 and a molecular weight of 353.36 g/mol. Its IUPAC name is 5-(3-fluoro-2-methylphenyl)-N-hydroxy-1-pyrazin-2-yl-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide.
| Compound Name | 5-(3-fluoro-2-methylphenyl)-N-hydroxy-1-pyrazin-2-yl-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118559901 |
| Molecular Formula | C18H16FN5O2 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5-(3-fluoro-2-methylphenyl)-N-hydroxy-1-pyrazin-2-yl-4,6-dihydrocyclopenta[d]pyrazole-5-carboxamide |
| SMILES | Cc1c(F)cccc1C1(C(=O)NO)Cc2cnn(-c3cnccn3)c2C1 |
| InChI | InChI=1S/C18H16FN5O2/c1-11-13(3-2-4-14(11)19)18(17(25)23-26)7-12-9-22-24(15(12)8-18)16-10-20-5-6-21-16/h2-6,9-10,26H,7-8H2,1H3,(H,23,25) |
| InChIKey | VCQDHQZHPNUNHZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|