C19H20FNO3 — CID 86272519
cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-phenoxycyclopentane-1-carboxamide (PubChem CID 86272519) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-phenoxycyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-phenoxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 86272519 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-phenoxycyclopentane-1-carboxamide |
| SMILES | Cc1c(F)cccc1[C@]1(C(=O)NO)CC[C@H](Oc2ccccc2)C1 |
| InChI | InChI=1S/C19H20FNO3/c1-13-16(8-5-9-17(13)20)19(18(22)21-23)11-10-15(12-19)24-14-6-3-2-4-7-14/h2-9,15,23H,10-12H2,1H3,(H,21,22)/t15-,19-/m0/s1 |
| InChIKey | WVKUWJVGASWANR-KXBFYZLASA-N |
| XLogP | 3.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|