C21H26FN3O2S2 — CID 162000832
cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-(3-methylbenzimidazol-5-yl)cyclopentane-1-carboxamide;sulfane (PubChem CID 162000832) has the molecular formula C21H26FN3O2S2 and a molecular weight of 435.59 g/mol. Its IUPAC name is cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-(3-methylbenzimidazol-5-yl)cyclopentane-1-carboxamide;sulfane.
| Compound Name | cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-(3-methylbenzimidazol-5-yl)cyclopentane-1-carboxamide;sulfane |
|---|---|
| PubChem CID | 162000832 |
| Molecular Formula | C21H26FN3O2S2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | cis-(1S,3S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-(3-methylbenzimidazol-5-yl)cyclopentane-1-carboxamide;sulfane |
| SMILES | Cc1c(F)cccc1[C@]1(C(=O)NO)CC[C@H](c2ccc3ncn(C)c3c2)C1.S.S |
| InChI | InChI=1S/C21H22FN3O2.2H2S/c1-13-16(4-3-5-17(13)22)21(20(26)24-27)9-8-15(11-21)14-6-7-18-19(10-14)25(2)12-23-18;;/h3-7,10,12,15,27H,8-9,11H2,1-2H3,(H,24,26);2*1H2/t15-,21-;;/m0../s1 |
| InChIKey | YSEMXYYDGZEIAO-JPGZUURYSA-N |
| XLogP | 3.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|