C17H21FN2O2S2 — CID 158584645
cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide;sulfane (PubChem CID 158584645) has the molecular formula C17H21FN2O2S2 and a molecular weight of 368.50 g/mol. Its IUPAC name is cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide;sulfane.
| Compound Name | cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide;sulfane |
|---|---|
| PubChem CID | 158584645 |
| Molecular Formula | C17H21FN2O2S2 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide;sulfane |
| SMILES | O=C(NO)[C@@]1(c2ccccc2)CC[C@H](c2cncc(F)c2)C1.S.S |
| InChI | InChI=1S/C17H17FN2O2.2H2S/c18-15-8-13(10-19-11-15)12-6-7-17(9-12,16(21)20-22)14-4-2-1-3-5-14;;/h1-5,8,10-12,22H,6-7,9H2,(H,20,21);2*1H2/t12-,17-;;/m0../s1 |
| InChIKey | HTRHEIWFEZOCSY-RSAMZESZSA-N |
| XLogP | 3.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|