C8H6Br2FN — CID 126979804
3-(2,2-dibromocyclopropyl)-5-fluoropyridine (PubChem CID 126979804) has the molecular formula C8H6Br2FN and a molecular weight of 294.95 g/mol. Its IUPAC name is 3-(2,2-dibromocyclopropyl)-5-fluoropyridine.
| Compound Name | 3-(2,2-dibromocyclopropyl)-5-fluoropyridine |
|---|---|
| PubChem CID | 126979804 |
| Molecular Formula | C8H6Br2FN |
| Molecular Weight | 294.95 g/mol |
| Exact Mass | 292.89 |
| IUPAC Name | 3-(2,2-dibromocyclopropyl)-5-fluoropyridine |
| SMILES | Fc1cncc(C2CC2(Br)Br)c1 |
| InChI | InChI=1S/C8H6Br2FN/c9-8(10)2-7(8)5-1-6(11)4-12-3-5/h1,3-4,7H,2H2 |
| InChIKey | BWOHDKOSKWZZSB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.95 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|