C11H15FN2 — CID 169114355
3-fluoro-5-[(2R,5S)-5-methylpiperidin-2-yl]pyridine (PubChem CID 169114355) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 3-fluoro-5-[(2R,5S)-5-methylpiperidin-2-yl]pyridine.
| Compound Name | 3-fluoro-5-[(2R,5S)-5-methylpiperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 169114355 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-fluoro-5-[(2R,5S)-5-methylpiperidin-2-yl]pyridine |
| SMILES | C[C@H]1CC[C@H](c2cncc(F)c2)NC1 |
| InChI | InChI=1S/C11H15FN2/c1-8-2-3-11(14-5-8)9-4-10(12)7-13-6-9/h4,6-8,11,14H,2-3,5H2,1H3/t8-,11+/m0/s1 |
| InChIKey | QIEVCXNTXCADGA-GZMMTYOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |