C12H15ClFN — CID 170904340
(2R,5S)-2-(4-chloro-3-fluorophenyl)-5-methylpiperidine (PubChem CID 170904340) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is (2R,5S)-2-(4-chloro-3-fluorophenyl)-5-methylpiperidine.
| Compound Name | (2R,5S)-2-(4-chloro-3-fluorophenyl)-5-methylpiperidine |
|---|---|
| PubChem CID | 170904340 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (2R,5S)-2-(4-chloro-3-fluorophenyl)-5-methylpiperidine |
| SMILES | C[C@H]1CC[C@H](c2ccc(Cl)c(F)c2)NC1 |
| InChI | InChI=1S/C12H15ClFN/c1-8-2-5-12(15-7-8)9-3-4-10(13)11(14)6-9/h3-4,6,8,12,15H,2,5,7H2,1H3/t8-,12+/m0/s1 |
| InChIKey | FVCYJKKADIAFSU-QPUJVOFHSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |