About 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline
3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline (PubChem CID 169113739) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline.
Molecular Properties
| Compound Name | 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline |
| PubChem CID | 169113739 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline |
| SMILES | Cc1cnc2cc([C@H]3CC[C@H](C)CN3)ccc2c1 |
| InChI | InChI=1S/C16H20N2/c1-11-3-6-15(17-9-11)14-5-4-13-7-12(2)10-18-16(13)8-14/h4-5,7-8,10-11,15,17H,3,6,9H2,1-2H3/t11-,15+/m0/s1 |
| InChIKey | XZJQHAJANSSKSV-XHDPSFHLSA-N |
| XLogP | 3.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline?
The IUPAC name of 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline (CID 169113739) is 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline.
What is the SMILES notation for 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline?
The canonical SMILES for 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline is Cc1cnc2cc([C@H]3CC[C@H](C)CN3)ccc2c1.
What is the InChIKey of 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline?
The InChIKey is XZJQHAJANSSKSV-XHDPSFHLSA-N. The full InChI is InChI=1S/C16H20N2/c1-11-3-6-15(17-9-11)14-5-4-13-7-12(2)10-18-16(13)8-14/h4-5,7-8,10-11,15,17H,3,6,9H2,1-2H3/t11-,15+/m0/s1.
What are the key properties of 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline?
3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline has a molecular weight of 240.35 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-[(2R,5S)-5-methylpiperidin-2-yl]quinoline is sourced from PubChem (CID 169113739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).