C9H10F2N2 — CID 126623835
3-fluoro-5-[(2S,4S)-4-fluoropyrrolidin-2-yl]pyridine (PubChem CID 126623835) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-fluoro-5-[(2S,4S)-4-fluoropyrrolidin-2-yl]pyridine.
| Compound Name | 3-fluoro-5-[(2S,4S)-4-fluoropyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 126623835 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-fluoro-5-[(2S,4S)-4-fluoropyrrolidin-2-yl]pyridine |
| SMILES | Fc1cncc([C@@H]2C[C@H](F)CN2)c1 |
| InChI | InChI=1S/C9H10F2N2/c10-7-1-6(3-12-4-7)9-2-8(11)5-13-9/h1,3-4,8-9,13H,2,5H2/t8-,9-/m0/s1 |
| InChIKey | KCKAIFFKJSPMKW-IUCAKERBSA-N |
| XLogP | 1.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |