About 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide
4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide (PubChem CID 153334918) has the molecular formula C10H12BrF2NO
and a molecular weight of 280.11 g/mol. Its IUPAC name is 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide.
Molecular Properties
| Compound Name | 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide |
| PubChem CID | 153334918 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide |
| SMILES | Br.Oc1ccc(F)cc1[C@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C10H11F2NO.BrH/c11-6-1-2-10(14)8(3-6)9-4-7(12)5-13-9;/h1-3,7,9,13-14H,4-5H2;1H/t7-,9+;/m0./s1 |
| InChIKey | JVQYDGXNBZAHIM-DKXTVVGFSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide?
The IUPAC name of 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide (CID 153334918) is 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide.
What is the SMILES notation for 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide?
The canonical SMILES for 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide is Br.Oc1ccc(F)cc1[C@H]1C[C@H](F)CN1.
What is the InChIKey of 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide?
The InChIKey is JVQYDGXNBZAHIM-DKXTVVGFSA-N. The full InChI is InChI=1S/C10H11F2NO.BrH/c11-6-1-2-10(14)8(3-6)9-4-7(12)5-13-9;/h1-3,7,9,13-14H,4-5H2;1H/t7-,9+;/m0./s1.
What are the key properties of 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide?
4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide has a molecular weight of 280.11 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[(2R,4S)-4-fluoropyrrolidin-2-yl]phenol;hydrobromide is sourced from PubChem (CID 153334918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).