C15H22FNO — CID 10777150
2-[(1R,2S)-2-(dipropylamino)cyclopropyl]-4-fluorophenol (PubChem CID 10777150) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(dipropylamino)cyclopropyl]-4-fluorophenol.
| Compound Name | 2-[(1R,2S)-2-(dipropylamino)cyclopropyl]-4-fluorophenol |
|---|---|
| PubChem CID | 10777150 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[(1R,2S)-2-(dipropylamino)cyclopropyl]-4-fluorophenol |
| SMILES | CCCN(CCC)[C@H]1C[C@@H]1c1cc(F)ccc1O |
| InChI | InChI=1S/C15H22FNO/c1-3-7-17(8-4-2)14-10-12(14)13-9-11(16)5-6-15(13)18/h5-6,9,12,14,18H,3-4,7-8,10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | OBBOTVUAHYTMPG-OCCSQVGLSA-N |
| XLogP | 3.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |