C10H10ClF2N — CID 126652081
(2R,4S)-2-(3-chloro-5-fluorophenyl)-4-fluoropyrrolidine (PubChem CID 126652081) has the molecular formula C10H10ClF2N and a molecular weight of 217.65 g/mol. Its IUPAC name is (2R,4S)-2-(3-chloro-5-fluorophenyl)-4-fluoropyrrolidine.
| Compound Name | (2R,4S)-2-(3-chloro-5-fluorophenyl)-4-fluoropyrrolidine |
|---|---|
| PubChem CID | 126652081 |
| Molecular Formula | C10H10ClF2N |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (2R,4S)-2-(3-chloro-5-fluorophenyl)-4-fluoropyrrolidine |
| SMILES | Fc1cc(Cl)cc([C@H]2C[C@H](F)CN2)c1 |
| InChI | InChI=1S/C10H10ClF2N/c11-7-1-6(2-8(12)3-7)10-4-9(13)5-14-10/h1-3,9-10,14H,4-5H2/t9-,10+/m0/s1 |
| InChIKey | WXQAYUYHBYDULK-VHSXEESVSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |