C17H17FN2O2 — CID 86274412
cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide (PubChem CID 86274412) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 86274412 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | cis-(1S,3S)-3-(5-fluoro-3-pyridinyl)-N-hydroxy-1-phenylcyclopentane-1-carboxamide |
| SMILES | O=C(NO)[C@@]1(c2ccccc2)CC[C@H](c2cncc(F)c2)C1 |
| InChI | InChI=1S/C17H17FN2O2/c18-15-8-13(10-19-11-15)12-6-7-17(9-12,16(21)20-22)14-4-2-1-3-5-14/h1-5,8,10-12,22H,6-7,9H2,(H,20,21)/t12-,17-/m0/s1 |
| InChIKey | XUCNSDHIOWERNL-SJCJKPOMSA-N |
| XLogP | 2.93 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|