C31H53NO4 — CID 146221151
3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl N-cyclohexylcarbamate (PubChem CID 146221151) has the molecular formula C31H53NO4 and a molecular weight of 503.77 g/mol. Its IUPAC name is 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl N-cyclohexylcarbamate.
| Compound Name | 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 146221151 |
| Molecular Formula | C31H53NO4 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.40 |
| IUPAC Name | 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl N-cyclohexylcarbamate |
| SMILES | CC[C@H]1[C@@H](O)[C@@H]2[C@H](CC[C@]3(C)[C@@H](CCCOC(=O)NC4CCCCC4)CC[C@@H]23)[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C31H53NO4/c1-4-23-26-19-22(33)14-16-31(26,3)25-15-17-30(2)20(12-13-24(30)27(25)28(23)34)9-8-18-36-29(35)32-21-10-6-5-7-11-21/h20-28,33-34H,4-19H2,1-3H3,(H,32,35)/t20-,22+,23+,24-,25-,26-,27-,28+,30+,31+/m0/s1 |
| InChIKey | HWEYXLFQSGLLEH-RAFIQFONSA-N |
| XLogP | 6.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|