C29H49NO5 — CID 146221200
3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl morpholine-4-carboxylate (PubChem CID 146221200) has the molecular formula C29H49NO5 and a molecular weight of 491.71 g/mol. Its IUPAC name is 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl morpholine-4-carboxylate.
| Compound Name | 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 146221200 |
| Molecular Formula | C29H49NO5 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | 3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl morpholine-4-carboxylate |
| SMILES | CC[C@H]1[C@@H](O)[C@@H]2[C@H](CC[C@]3(C)[C@@H](CCCOC(=O)N4CCOCC4)CC[C@@H]23)[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C29H49NO5/c1-4-21-24-18-20(31)9-11-29(24,3)23-10-12-28(2)19(7-8-22(28)25(23)26(21)32)6-5-15-35-27(33)30-13-16-34-17-14-30/h19-26,31-32H,4-18H2,1-3H3/t19-,20+,21+,22-,23-,24-,25-,26+,28+,29+/m0/s1 |
| InChIKey | JCVSBUYNICVMIZ-KOKBOOCBSA-N |
| XLogP | 4.86 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|