C23H25NO6S — CID 146222359
3-(benzenesulfonyl)-6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-1H-pyridin-2-one (PubChem CID 146222359) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-1H-pyridin-2-one.
| Compound Name | 3-(benzenesulfonyl)-6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 146222359 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 3-(benzenesulfonyl)-6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-1H-pyridin-2-one |
| SMILES | CCCCc1[nH]c(=O)c(S(=O)(=O)c2ccccc2)c(O)c1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C23H25NO6S/c1-4-5-12-16-19(20-17(29-2)13-9-14-18(20)30-3)21(25)22(23(26)24-16)31(27,28)15-10-7-6-8-11-15/h6-11,13-14H,4-5,12H2,1-3H3,(H2,24,25,26) |
| InChIKey | RDQVGRZONDVMSX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |