C22H30N2O5 — CID 145200805
propyl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate (PubChem CID 145200805) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is propyl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate.
| Compound Name | propyl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200805 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | propyl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
| SMILES | CCCCc1[nH]c(=O)c(/C(=N/C)OCCC)c(O)c1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C22H30N2O5/c1-6-8-10-14-17(18-15(27-4)11-9-12-16(18)28-5)20(25)19(21(26)24-14)22(23-3)29-13-7-2/h9,11-12H,6-8,10,13H2,1-5H3,(H2,24,25,26)/b23-22- |
| InChIKey | ZOXWWZGCGZGGOZ-FCQUAONHSA-N |
| XLogP | 3.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|