C28H30F2N2O6 — CID 145200694
3-(3,4-difluorophenoxy)prop-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate (PubChem CID 145200694) has the molecular formula C28H30F2N2O6 and a molecular weight of 528.55 g/mol. Its IUPAC name is 3-(3,4-difluorophenoxy)prop-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate.
| Compound Name | 3-(3,4-difluorophenoxy)prop-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200694 |
| Molecular Formula | C28H30F2N2O6 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 3-(3,4-difluorophenoxy)prop-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
| SMILES | C=C(COc1ccc(F)c(F)c1)O/C(=N\C)c1c(O)c(-c2c(OC)cccc2OC)c(CCCC)[nH]c1=O |
| InChI | InChI=1S/C28H30F2N2O6/c1-6-7-9-20-23(24-21(35-4)10-8-11-22(24)36-5)26(33)25(27(34)32-20)28(31-3)38-16(2)15-37-17-12-13-18(29)19(30)14-17/h8,10-14H,2,6-7,9,15H2,1,3-5H3,(H2,32,33,34)/b31-28- |
| InChIKey | DVTXWZLOWPJDOW-PNOGMODKSA-N |
| XLogP | 5.37 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|