C29H31ClN2O5 — CID 145200750
3-(4-chlorophenyl)prop-1-en-2-yl 6-cyclopentyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate (PubChem CID 145200750) has the molecular formula C29H31ClN2O5 and a molecular weight of 523.03 g/mol. Its IUPAC name is 3-(4-chlorophenyl)prop-1-en-2-yl 6-cyclopentyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate.
| Compound Name | 3-(4-chlorophenyl)prop-1-en-2-yl 6-cyclopentyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200750 |
| Molecular Formula | C29H31ClN2O5 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 3-(4-chlorophenyl)prop-1-en-2-yl 6-cyclopentyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
| SMILES | C=C(Cc1ccc(Cl)cc1)O/C(=N\C)c1c(O)c(-c2c(OC)cccc2OC)c(C2CCCC2)[nH]c1=O |
| InChI | InChI=1S/C29H31ClN2O5/c1-17(16-18-12-14-20(30)15-13-18)37-29(31-2)25-27(33)24(23-21(35-3)10-7-11-22(23)36-4)26(32-28(25)34)19-8-5-6-9-19/h7,10-15,19H,1,5-6,8-9,16H2,2-4H3,(H2,32,33,34)/b31-29- |
| InChIKey | VNBWKCOTKKASPJ-YCNYHXFESA-N |
| XLogP | 6.23 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|