C33H40N2O4 — CID 145200913
4-(2-methoxyphenyl)penta-1,4-dien-2-yl 6-butyl-5-(2,6-diethylphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate (PubChem CID 145200913) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)penta-1,4-dien-2-yl 6-butyl-5-(2,6-diethylphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate.
| Compound Name | 4-(2-methoxyphenyl)penta-1,4-dien-2-yl 6-butyl-5-(2,6-diethylphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200913 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 4-(2-methoxyphenyl)penta-1,4-dien-2-yl 6-butyl-5-(2,6-diethylphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
| SMILES | C=C(CC(=C)c1ccccc1OC)O/C(=N\C)c1c(O)c(-c2c(CC)cccc2CC)c(CCCC)[nH]c1=O |
| InChI | InChI=1S/C33H40N2O4/c1-8-11-18-26-29(28-23(9-2)15-14-16-24(28)10-3)31(36)30(32(37)35-26)33(34-6)39-22(5)20-21(4)25-17-12-13-19-27(25)38-7/h12-17,19H,4-5,8-11,18,20H2,1-3,6-7H3,(H2,35,36,37)/b34-33- |
| InChIKey | UDWPVNCKRQYNCQ-YHZPTAEISA-N |
| XLogP | 7.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|