C27H35N3O7 — CID 145200854
but-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate;pyrrolidine-2,4-dione (PubChem CID 145200854) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is but-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate;pyrrolidine-2,4-dione.
| Compound Name | but-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate;pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 145200854 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | but-1-en-2-yl 6-butyl-5-(2,6-dimethoxyphenyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate;pyrrolidine-2,4-dione |
| SMILES | C=C(CC)O/C(=N\C)c1c(O)c(-c2c(OC)cccc2OC)c(CCCC)[nH]c1=O.O=C1CNC(=O)C1 |
| InChI | InChI=1S/C23H30N2O5.C4H5NO2/c1-7-9-11-15-18(19-16(28-5)12-10-13-17(19)29-6)21(26)20(22(27)25-15)23(24-4)30-14(3)8-2;6-3-1-4(7)5-2-3/h10,12-13H,3,7-9,11H2,1-2,4-6H3,(H2,25,26,27);1-2H2,(H,5,7)/b24-23-; |
| InChIKey | SCLDZUYQWWBZED-DCXSSQDFSA-N |
| XLogP | 3.50 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|