C27H25F5N2O4 — CID 145200809
3-(3,4-difluorophenyl)prop-1-en-2-yl 6-butyl-4-hydroxy-N-methyl-2-oxo-5-[3-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboximidate (PubChem CID 145200809) has the molecular formula C27H25F5N2O4 and a molecular weight of 536.50 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)prop-1-en-2-yl 6-butyl-4-hydroxy-N-methyl-2-oxo-5-[3-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboximidate.
| Compound Name | 3-(3,4-difluorophenyl)prop-1-en-2-yl 6-butyl-4-hydroxy-N-methyl-2-oxo-5-[3-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200809 |
| Molecular Formula | C27H25F5N2O4 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 3-(3,4-difluorophenyl)prop-1-en-2-yl 6-butyl-4-hydroxy-N-methyl-2-oxo-5-[3-(trifluoromethoxy)phenyl]-1H-pyridine-3-carboximidate |
| SMILES | C=C(Cc1ccc(F)c(F)c1)O/C(=N\C)c1c(O)c(-c2cccc(OC(F)(F)F)c2)c(CCCC)[nH]c1=O |
| InChI | InChI=1S/C27H25F5N2O4/c1-4-5-9-21-22(17-7-6-8-18(14-17)38-27(30,31)32)24(35)23(25(36)34-21)26(33-3)37-15(2)12-16-10-11-19(28)20(29)13-16/h6-8,10-11,13-14H,2,4-5,9,12H2,1,3H3,(H2,34,35,36)/b33-26- |
| InChIKey | GXJKNAHCHCCKCB-MKFPQRGTSA-N |
| XLogP | 6.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|