C27H30ClN2O6P — CID 145200915
3-(4-chlorophenyl)prop-1-en-2-yl 5-(2,6-dimethoxy-4-phosphanylphenyl)-6-(ethoxymethyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate (PubChem CID 145200915) has the molecular formula C27H30ClN2O6P and a molecular weight of 544.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)prop-1-en-2-yl 5-(2,6-dimethoxy-4-phosphanylphenyl)-6-(ethoxymethyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate.
| Compound Name | 3-(4-chlorophenyl)prop-1-en-2-yl 5-(2,6-dimethoxy-4-phosphanylphenyl)-6-(ethoxymethyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
|---|---|
| PubChem CID | 145200915 |
| Molecular Formula | C27H30ClN2O6P |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-(4-chlorophenyl)prop-1-en-2-yl 5-(2,6-dimethoxy-4-phosphanylphenyl)-6-(ethoxymethyl)-4-hydroxy-N-methyl-2-oxo-1H-pyridine-3-carboximidate |
| SMILES | C=C(Cc1ccc(Cl)cc1)O/C(=N\C)c1c(O)c(-c2c(OC)cc(P)cc2OC)c(COCC)[nH]c1=O |
| InChI | InChI=1S/C27H30ClN2O6P/c1-6-35-14-19-22(23-20(33-4)12-18(37)13-21(23)34-5)25(31)24(26(32)30-19)27(29-3)36-15(2)11-16-7-9-17(28)10-8-16/h7-10,12-13H,2,6,11,14,37H2,1,3-5H3,(H2,30,31,32)/b29-27- |
| InChIKey | XFNISYMBZGYRAX-OHYPFYFLSA-N |
| XLogP | 4.60 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|