C21H24O7 — CID 146223044
2-(3-ethoxy-4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 146223044) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-(3-ethoxy-4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-(3-ethoxy-4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 146223044 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(3-ethoxy-4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(CCOC(=O)/C=C/c2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H24O7/c1-4-27-17-11-14(5-7-16(17)22)9-10-28-20(23)8-6-15-12-18(25-2)21(24)19(13-15)26-3/h5-8,11-13,22,24H,4,9-10H2,1-3H3/b8-6+ |
| InChIKey | OHBFIGHAJBEIMF-SOFGYWHQSA-N |
| XLogP | 3.31 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|