C34H51N5O4 — CID 146223253
6-[cyclohexyl(ethyl)amino]-5-ethyl-N-[(2Z,4Z)-5-formamido-3-methoxy-2-methylhexa-2,4-dienyl]-2-[(4-methylpiperazin-1-yl)methyl]-1-benzofuran-4-carboxamide (PubChem CID 146223253) has the molecular formula C34H51N5O4 and a molecular weight of 593.81 g/mol. Its IUPAC name is 6-[cyclohexyl(ethyl)amino]-5-ethyl-N-[(2Z,4Z)-5-formamido-3-methoxy-2-methylhexa-2,4-dienyl]-2-[(4-methylpiperazin-1-yl)methyl]-1-benzofuran-4-carboxamide.
| Compound Name | 6-[cyclohexyl(ethyl)amino]-5-ethyl-N-[(2Z,4Z)-5-formamido-3-methoxy-2-methylhexa-2,4-dienyl]-2-[(4-methylpiperazin-1-yl)methyl]-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 146223253 |
| Molecular Formula | C34H51N5O4 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.39 |
| IUPAC Name | 6-[cyclohexyl(ethyl)amino]-5-ethyl-N-[(2Z,4Z)-5-formamido-3-methoxy-2-methylhexa-2,4-dienyl]-2-[(4-methylpiperazin-1-yl)methyl]-1-benzofuran-4-carboxamide |
| SMILES | CCc1c(N(CC)C2CCCCC2)cc2oc(CN3CCN(C)CC3)cc2c1C(=O)NC/C(C)=C(/C=C(/C)NC=O)OC |
| InChI | InChI=1S/C34H51N5O4/c1-7-28-30(39(8-2)26-12-10-9-11-13-26)20-32-29(19-27(43-32)22-38-16-14-37(5)15-17-38)33(28)34(41)35-21-24(3)31(42-6)18-25(4)36-23-40/h18-20,23,26H,7-17,21-22H2,1-6H3,(H,35,41)(H,36,40)/b25-18-,31-24- |
| InChIKey | FIEBHHBVGITHIE-YTWGJQNBSA-N |
| XLogP | 5.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|