C16H25N3O4 — CID 146224133
ethyl 4-[1-(hydrazinecarbonyloxy)hexan-2-ylamino]benzoate (PubChem CID 146224133) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 4-[1-(hydrazinecarbonyloxy)hexan-2-ylamino]benzoate.
| Compound Name | ethyl 4-[1-(hydrazinecarbonyloxy)hexan-2-ylamino]benzoate |
|---|---|
| PubChem CID | 146224133 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | ethyl 4-[1-(hydrazinecarbonyloxy)hexan-2-ylamino]benzoate |
| SMILES | CCCCC(COC(=O)NN)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C16H25N3O4/c1-3-5-6-14(11-23-16(21)19-17)18-13-9-7-12(8-10-13)15(20)22-4-2/h7-10,14,18H,3-6,11,17H2,1-2H3,(H,19,21) |
| InChIKey | MESRZMMWUUPGSK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|