C45H90BrNO3 — CID 146224934
1,2-bis[(Z)-octadec-9-enoxy]propyl-(4-hydroxybutyl)-dimethylazanium bromide (PubChem CID 146224934) has the molecular formula C45H90BrNO3 and a molecular weight of 773.12 g/mol. Its IUPAC name is 1,2-bis[(Z)-octadec-9-enoxy]propyl-(4-hydroxybutyl)-dimethylazanium bromide.
| Compound Name | 1,2-bis[(Z)-octadec-9-enoxy]propyl-(4-hydroxybutyl)-dimethylazanium bromide |
|---|---|
| PubChem CID | 146224934 |
| Molecular Formula | C45H90BrNO3 |
| Molecular Weight | 773.12 g/mol |
| Exact Mass | 771.61 |
| IUPAC Name | 1,2-bis[(Z)-octadec-9-enoxy]propyl-(4-hydroxybutyl)-dimethylazanium bromide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(C)C(OCCCCCCCC/C=C\CCCCCCCC)[N+](C)(C)CCCCO.[Br-] |
| InChI | InChI=1S/C45H90NO3.BrH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-42-48-44(3)45(46(4,5)40-36-37-41-47)49-43-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,44-45,47H,6-19,24-43H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-; |
| InChIKey | ZFGWEVDKRDOZNX-LQDDAWAPSA-M |
| XLogP | 10.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.12 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|