C25H31N5O2 — CID 146225357
tert-butyl N-[[benzyl(methyl)amino]methyl]-N-[6-(4-methylanilino)pyrimidin-4-yl]carbamate (PubChem CID 146225357) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is tert-butyl N-[[benzyl(methyl)amino]methyl]-N-[6-(4-methylanilino)pyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[[benzyl(methyl)amino]methyl]-N-[6-(4-methylanilino)pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 146225357 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | tert-butyl N-[[benzyl(methyl)amino]methyl]-N-[6-(4-methylanilino)pyrimidin-4-yl]carbamate |
| SMILES | Cc1ccc(Nc2cc(N(CN(C)Cc3ccccc3)C(=O)OC(C)(C)C)ncn2)cc1 |
| InChI | InChI=1S/C25H31N5O2/c1-19-11-13-21(14-12-19)28-22-15-23(27-17-26-22)30(24(31)32-25(2,3)4)18-29(5)16-20-9-7-6-8-10-20/h6-15,17H,16,18H2,1-5H3,(H,26,27,28) |
| InChIKey | AKYVRCWGLPFKFV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|