C32H29N3O3 — CID 146225865
(E)-3-[5-methyl-4-oxo-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-7-yl]prop-2-enamide (PubChem CID 146225865) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is (E)-3-[5-methyl-4-oxo-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-methyl-4-oxo-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 146225865 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (E)-3-[5-methyl-4-oxo-3-(tritylamino)-2,3-dihydro-1,5-benzoxazepin-7-yl]prop-2-enamide |
| SMILES | CN1C(=O)C(NC(c2ccccc2)(c2ccccc2)c2ccccc2)COc2ccc(/C=C/C(N)=O)cc21 |
| InChI | InChI=1S/C32H29N3O3/c1-35-28-21-23(18-20-30(33)36)17-19-29(28)38-22-27(31(35)37)34-32(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-21,27,34H,22H2,1H3,(H2,33,36)/b20-18+ |
| InChIKey | MFHLCSAHSACCTG-CZIZESTLSA-N |
| XLogP | 4.49 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|