C21H26F3N3O3 — CID 146229462
2-methoxyethyl 2-[[(3R,5S)-5-methyl-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-yl]amino]acetate (PubChem CID 146229462) has the molecular formula C21H26F3N3O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-methoxyethyl 2-[[(3R,5S)-5-methyl-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-yl]amino]acetate.
| Compound Name | 2-methoxyethyl 2-[[(3R,5S)-5-methyl-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 146229462 |
| Molecular Formula | C21H26F3N3O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-methoxyethyl 2-[[(3R,5S)-5-methyl-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-yl]amino]acetate |
| SMILES | COCCOC(=O)CN[C@@H]1C[C@H](C)CN(c2ccc(C(F)(F)F)c3ncccc23)C1 |
| InChI | InChI=1S/C21H26F3N3O3/c1-14-10-15(26-11-19(28)30-9-8-29-2)13-27(12-14)18-6-5-17(21(22,23)24)20-16(18)4-3-7-25-20/h3-7,14-15,26H,8-13H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | HFIXOOXBQNWONC-LSDHHAIUSA-N |
| XLogP | 3.25 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|