C19H22F3N3OS — CID 146329389
5-methyl-N-(1-oxothietan-3-yl)-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-amine (PubChem CID 146329389) has the molecular formula C19H22F3N3OS and a molecular weight of 397.47 g/mol. Its IUPAC name is 5-methyl-N-(1-oxothietan-3-yl)-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-amine.
| Compound Name | 5-methyl-N-(1-oxothietan-3-yl)-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 146329389 |
| Molecular Formula | C19H22F3N3OS |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-methyl-N-(1-oxothietan-3-yl)-1-[8-(trifluoromethyl)quinolin-5-yl]piperidin-3-amine |
| SMILES | CC1CC(NC2CS(=O)C2)CN(c2ccc(C(F)(F)F)c3ncccc23)C1 |
| InChI | InChI=1S/C19H22F3N3OS/c1-12-7-13(24-14-10-27(26)11-14)9-25(8-12)17-5-4-16(19(20,21)22)18-15(17)3-2-6-23-18/h2-6,12-14,24H,7-11H2,1H3 |
| InChIKey | VSUWKKJHAHZFOU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |