C18H17F2N3O2S — CID 1462299
5-fluoro-1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]benzimidazole (PubChem CID 1462299) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is 5-fluoro-1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]benzimidazole.
| Compound Name | 5-fluoro-1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 1462299 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 5-fluoro-1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]benzimidazole |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCC(n2cnc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C18H17F2N3O2S/c19-13-1-4-16(5-2-13)26(24,25)22-9-7-15(8-10-22)23-12-21-17-11-14(20)3-6-18(17)23/h1-6,11-12,15H,7-10H2 |
| InChIKey | HYTDOQUCAJNLCU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |