C21H21FN2O5S — CID 88573937
[1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]indol-4-yl]oxymethyl formate (PubChem CID 88573937) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is [1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]indol-4-yl]oxymethyl formate.
| Compound Name | [1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]indol-4-yl]oxymethyl formate |
|---|---|
| PubChem CID | 88573937 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [1-[1-(4-fluorophenyl)sulfonylpiperidin-4-yl]indol-4-yl]oxymethyl formate |
| SMILES | O=COCOc1cccc2c1ccn2C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21FN2O5S/c22-16-4-6-18(7-5-16)30(26,27)23-11-8-17(9-12-23)24-13-10-19-20(24)2-1-3-21(19)29-15-28-14-25/h1-7,10,13-14,17H,8-9,11-12,15H2 |
| InChIKey | OCVRYAMSKFSEIV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|