C23H19F5N2O3 — CID 146230060
[2-(4-methoxyphenyl)pyrrolidin-1-yl]-[5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2-oxazol-3-yl]methanone (PubChem CID 146230060) has the molecular formula C23H19F5N2O3 and a molecular weight of 466.41 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)pyrrolidin-1-yl]-[5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2-oxazol-3-yl]methanone.
| Compound Name | [2-(4-methoxyphenyl)pyrrolidin-1-yl]-[5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 146230060 |
| Molecular Formula | C23H19F5N2O3 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [2-(4-methoxyphenyl)pyrrolidin-1-yl]-[5-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2-oxazol-3-yl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)c2cc(-c3ccc(C(F)(F)C(F)(F)F)cc3)on2)cc1 |
| InChI | InChI=1S/C23H19F5N2O3/c1-32-17-10-6-14(7-11-17)19-3-2-12-30(19)21(31)18-13-20(33-29-18)15-4-8-16(9-5-15)22(24,25)23(26,27)28/h4-11,13,19H,2-3,12H2,1H3 |
| InChIKey | JDTOQLXUJOZGOV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|