About bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate
bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate (PubChem CID 146230517) has the molecular formula C27H44O8
and a molecular weight of 496.64 g/mol. Its IUPAC name is bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate.
Molecular Properties
| Compound Name | bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate |
| PubChem CID | 146230517 |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate |
| SMILES | CC(CCCC(=O)OC(C)C(=O)OC1CCCCC1)CCC(=O)OC(C)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H44O8/c1-19(17-18-25(29)33-21(3)27(31)35-23-14-8-5-9-15-23)11-10-16-24(28)32-20(2)26(30)34-22-12-6-4-7-13-22/h19-23H,4-18H2,1-3H3 |
| InChIKey | ZVNXGDAPHGEEOM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate?
The IUPAC name of bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate (CID 146230517) is bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate.
What is the SMILES notation for bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate?
The canonical SMILES for bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate is CC(CCCC(=O)OC(C)C(=O)OC1CCCCC1)CCC(=O)OC(C)C(=O)OC1CCCCC1.
What is the InChIKey of bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate?
The InChIKey is ZVNXGDAPHGEEOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44O8/c1-19(17-18-25(29)33-21(3)27(31)35-23-14-8-5-9-15-23)11-10-16-24(28)32-20(2)26(30)34-22-12-6-4-7-13-22/h19-23H,4-18H2,1-3H3.
What are the key properties of bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate?
bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate has a molecular weight of 496.64 g/mol, XLogP of 5.19, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-cyclohexyloxy-1-oxopropan-2-yl) 4-methyloctanedioate is sourced from PubChem (CID 146230517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).