C56H36N8 — CID 146230615
2-phenyl-4-[6-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-4,5-dihydropyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazine (PubChem CID 146230615) has the molecular formula C56H36N8 and a molecular weight of 820.96 g/mol. Its IUPAC name is 2-phenyl-4-[6-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-4,5-dihydropyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[6-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-4,5-dihydropyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146230615 |
| Molecular Formula | C56H36N8 |
| Molecular Weight | 820.96 g/mol |
| Exact Mass | 820.31 |
| IUPAC Name | 2-phenyl-4-[6-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-4,5-dihydropyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccccn4)cc3)nc(-c3ccc4ccc5c(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccn8)cc7)n6)ccc6c5c4c3CC6)n2)cc1 |
| InChI | InChI=1S/C56H36N8/c1-3-11-39(12-4-1)51-59-53(41-21-17-35(18-22-41)47-15-7-9-33-57-47)63-55(61-51)45-31-27-37-26-30-44-46(32-28-38-25-29-43(45)49(37)50(38)44)56-62-52(40-13-5-2-6-14-40)60-54(64-56)42-23-19-36(20-24-42)48-16-8-10-34-58-48/h1-25,27-29,31-34H,26,30H2 |
| InChIKey | AZOFAVASMHAUCC-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.96 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|