C54H40N2 — CID 146232865
2-[4-[10-[4-(3,4-dihydropyridin-2-yl)cyclohexa-1,3-dien-1-yl]-3-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]pyridine (PubChem CID 146232865) has the molecular formula C54H40N2 and a molecular weight of 716.93 g/mol. Its IUPAC name is 2-[4-[10-[4-(3,4-dihydropyridin-2-yl)cyclohexa-1,3-dien-1-yl]-3-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]pyridine.
| Compound Name | 2-[4-[10-[4-(3,4-dihydropyridin-2-yl)cyclohexa-1,3-dien-1-yl]-3-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 146232865 |
| Molecular Formula | C54H40N2 |
| Molecular Weight | 716.93 g/mol |
| Exact Mass | 716.32 |
| IUPAC Name | 2-[4-[10-[4-(3,4-dihydropyridin-2-yl)cyclohexa-1,3-dien-1-yl]-3-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]pyridine |
| SMILES | C1=CN=C(C2=CC=C(c3c4ccccc4c(-c4ccc(-c5ccccn5)cc4)c4ccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)cc34)CC2)CC1 |
| InChI | InChI=1S/C54H40N2/c1-3-13-37(14-4-1)44-33-45(38-15-5-2-6-16-38)35-46(34-44)43-29-30-49-50(36-43)54(42-27-23-40(24-28-42)52-20-10-12-32-56-52)48-18-8-7-17-47(48)53(49)41-25-21-39(22-26-41)51-19-9-11-31-55-51/h1-9,11-19,21-23,25-27,29-36H,10,20,24,28H2 |
| InChIKey | AIWSEVAZIRNWRB-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.93 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|